N-[4-({[5-(2H-1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]methyl}sulfanyl)phenyl]-4-methylbenzamide
Chemical Structure Depiction of
N-[4-({[5-(2H-1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]methyl}sulfanyl)phenyl]-4-methylbenzamide
N-[4-({[5-(2H-1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]methyl}sulfanyl)phenyl]-4-methylbenzamide
Compound characteristics
| Compound ID: | L150-0932 |
| Compound Name: | N-[4-({[5-(2H-1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]methyl}sulfanyl)phenyl]-4-methylbenzamide |
| Molecular Weight: | 445.5 |
| Molecular Formula: | C24 H19 N3 O4 S |
| Smiles: | Cc1ccc(cc1)C(Nc1ccc(cc1)SCc1nnc(c2ccc3c(c2)OCO3)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8978 |
| logD: | 4.8976 |
| logSw: | -4.6117 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.355 |
| InChI Key: | XZARNWHUJRCODO-UHFFFAOYSA-N |