(oxolan-2-yl)methyl 3-{[(2-chlorophenyl)methyl]amino}quinoxaline-2-carboxylate
Chemical Structure Depiction of
(oxolan-2-yl)methyl 3-{[(2-chlorophenyl)methyl]amino}quinoxaline-2-carboxylate
(oxolan-2-yl)methyl 3-{[(2-chlorophenyl)methyl]amino}quinoxaline-2-carboxylate
Compound characteristics
| Compound ID: | L150-0968 |
| Compound Name: | (oxolan-2-yl)methyl 3-{[(2-chlorophenyl)methyl]amino}quinoxaline-2-carboxylate |
| Molecular Weight: | 397.86 |
| Molecular Formula: | C21 H20 Cl N3 O3 |
| Smiles: | C1CC(COC(c2c(NCc3ccccc3[Cl])nc3ccccc3n2)=O)OC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8145 |
| logD: | 3.8145 |
| logSw: | -4.1138 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.328 |
| InChI Key: | HQEYZCSUXLVGEH-OAHLLOKOSA-N |