3-{[(4-methylphenyl)methyl]sulfanyl}-1H-1,2,4-triazol-5-amine
Chemical Structure Depiction of
3-{[(4-methylphenyl)methyl]sulfanyl}-1H-1,2,4-triazol-5-amine
3-{[(4-methylphenyl)methyl]sulfanyl}-1H-1,2,4-triazol-5-amine
Compound characteristics
| Compound ID: | L150-1093 |
| Compound Name: | 3-{[(4-methylphenyl)methyl]sulfanyl}-1H-1,2,4-triazol-5-amine |
| Molecular Weight: | 220.29 |
| Molecular Formula: | C10 H12 N4 S |
| Smiles: | Cc1ccc(CSc2nc(N)[nH]n2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 1.9007 |
| logD: | 1.8962 |
| logSw: | -2.0623 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 53.211 |
| InChI Key: | MVFRBGYNIPHBHO-UHFFFAOYSA-N |