5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(furan-2-yl)propyl]-N,2-dimethylthiophene-3-sulfonamide
Chemical Structure Depiction of
5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(furan-2-yl)propyl]-N,2-dimethylthiophene-3-sulfonamide
5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(furan-2-yl)propyl]-N,2-dimethylthiophene-3-sulfonamide
Compound characteristics
| Compound ID: | L233-1561 |
| Compound Name: | 5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(furan-2-yl)propyl]-N,2-dimethylthiophene-3-sulfonamide |
| Molecular Weight: | 477.99 |
| Molecular Formula: | C21 H20 Cl N3 O4 S2 |
| Smiles: | Cc1c(cc(c2nc(c3cccc(c3)[Cl])no2)s1)S(N(C)CCCc1ccco1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8293 |
| logD: | 5.8293 |
| logSw: | -6.0101 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 72.954 |
| InChI Key: | VAQPWVBSNGWPEX-UHFFFAOYSA-N |