N-[(3-chlorophenyl)methyl]-2-[1-(2-phenyl-1,3-benzoxazole-6-carbonyl)piperidin-4-yl]acetamide
Chemical Structure Depiction of
N-[(3-chlorophenyl)methyl]-2-[1-(2-phenyl-1,3-benzoxazole-6-carbonyl)piperidin-4-yl]acetamide
N-[(3-chlorophenyl)methyl]-2-[1-(2-phenyl-1,3-benzoxazole-6-carbonyl)piperidin-4-yl]acetamide
Compound characteristics
| Compound ID: | L250-0974 |
| Compound Name: | N-[(3-chlorophenyl)methyl]-2-[1-(2-phenyl-1,3-benzoxazole-6-carbonyl)piperidin-4-yl]acetamide |
| Molecular Weight: | 487.99 |
| Molecular Formula: | C28 H26 Cl N3 O3 |
| Smiles: | [H]C(C1CCN(CC1)C(c1ccc2c(c1)oc(c1ccccc1)n2)=O)C(NCc1cccc(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.891 |
| logD: | 4.891 |
| logSw: | -5.135 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.897 |
| InChI Key: | FIRGGCZYVDVVKU-UHFFFAOYSA-N |