N-[{[(5-bromo-2-methoxyphenyl)methyl]amino}(3,4-dimethoxyanilino)methylidene]methanesulfonamide
Chemical Structure Depiction of
N-[{[(5-bromo-2-methoxyphenyl)methyl]amino}(3,4-dimethoxyanilino)methylidene]methanesulfonamide
N-[{[(5-bromo-2-methoxyphenyl)methyl]amino}(3,4-dimethoxyanilino)methylidene]methanesulfonamide
Compound characteristics
| Compound ID: | L261-0607 |
| Compound Name: | N-[{[(5-bromo-2-methoxyphenyl)methyl]amino}(3,4-dimethoxyanilino)methylidene]methanesulfonamide |
| Molecular Weight: | 472.36 |
| Molecular Formula: | C18 H22 Br N3 O5 S |
| Smiles: | COc1ccc(cc1CN\C(Nc1ccc(c(c1)OC)OC)=N/S(C)(=O)=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.838 |
| logD: | 2.8379 |
| logSw: | -3.4828 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 83.262 |
| InChI Key: | QNXBAHARHNCOTH-UHFFFAOYSA-N |