5-[(4-ethylbenzene-1-sulfonyl)amino]-2-(piperazin-1-yl)-N-propylbenzamide--trifluoroacetic acid (1/1)
Chemical Structure Depiction of
5-[(4-ethylbenzene-1-sulfonyl)amino]-2-(piperazin-1-yl)-N-propylbenzamide--trifluoroacetic acid (1/1)
5-[(4-ethylbenzene-1-sulfonyl)amino]-2-(piperazin-1-yl)-N-propylbenzamide--trifluoroacetic acid (1/1)
Compound characteristics
| Compound ID: | L268-0527 |
| Compound Name: | 5-[(4-ethylbenzene-1-sulfonyl)amino]-2-(piperazin-1-yl)-N-propylbenzamide--trifluoroacetic acid (1/1) |
| Molecular Weight: | 544.59 |
| Molecular Formula: | C22 H30 N4 O3 S |
| Salt: | CF3COOH |
| Smiles: | CCCNC(c1cc(ccc1N1CCNCC1)NS(c1ccc(CC)cc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4201 |
| logD: | 1.9446 |
| logSw: | -3.9238 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 80.527 |
| InChI Key: | PKKAQQWGVFKXGY-UHFFFAOYSA-N |