1-methyl-2-({methyl[4-(propan-2-yl)benzene-1-sulfonyl]amino}methyl)-N-(propan-2-yl)-1H-benzimidazole-5-carboxamide
Chemical Structure Depiction of
1-methyl-2-({methyl[4-(propan-2-yl)benzene-1-sulfonyl]amino}methyl)-N-(propan-2-yl)-1H-benzimidazole-5-carboxamide
1-methyl-2-({methyl[4-(propan-2-yl)benzene-1-sulfonyl]amino}methyl)-N-(propan-2-yl)-1H-benzimidazole-5-carboxamide
Compound characteristics
| Compound ID: | L278-0624 |
| Compound Name: | 1-methyl-2-({methyl[4-(propan-2-yl)benzene-1-sulfonyl]amino}methyl)-N-(propan-2-yl)-1H-benzimidazole-5-carboxamide |
| Molecular Weight: | 442.58 |
| Molecular Formula: | C23 H30 N4 O3 S |
| Smiles: | CC(C)c1ccc(cc1)S(N(C)Cc1nc2cc(ccc2n1C)C(NC(C)C)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7619 |
| logD: | 3.7421 |
| logSw: | -4.0005 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.448 |
| InChI Key: | PUEHYDXNWGKQRB-UHFFFAOYSA-N |