(azepan-1-yl){3-[3-(3,4-dihydroisoquinoline-2(1H)-sulfonyl)-4-methylphenyl]-1,2,4-oxadiazol-5-yl}methanone
Chemical Structure Depiction of
(azepan-1-yl){3-[3-(3,4-dihydroisoquinoline-2(1H)-sulfonyl)-4-methylphenyl]-1,2,4-oxadiazol-5-yl}methanone
(azepan-1-yl){3-[3-(3,4-dihydroisoquinoline-2(1H)-sulfonyl)-4-methylphenyl]-1,2,4-oxadiazol-5-yl}methanone
Compound characteristics
| Compound ID: | L286-1658 |
| Compound Name: | (azepan-1-yl){3-[3-(3,4-dihydroisoquinoline-2(1H)-sulfonyl)-4-methylphenyl]-1,2,4-oxadiazol-5-yl}methanone |
| Molecular Weight: | 480.59 |
| Molecular Formula: | C25 H28 N4 O4 S |
| Smiles: | Cc1ccc(cc1S(N1CCc2ccccc2C1)(=O)=O)c1nc(C(N2CCCCCC2)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.9964 |
| logD: | 4.9964 |
| logSw: | -4.55 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 80.268 |
| InChI Key: | WZFYHEREOBNAHS-UHFFFAOYSA-N |