3-(3,5-dimethyl-1-benzofuran-2-yl)-N-({1-[(2-fluorophenyl)methyl]piperidin-4-yl}methyl)-1,2,4-oxadiazole-5-carboxamide
Chemical Structure Depiction of
3-(3,5-dimethyl-1-benzofuran-2-yl)-N-({1-[(2-fluorophenyl)methyl]piperidin-4-yl}methyl)-1,2,4-oxadiazole-5-carboxamide
3-(3,5-dimethyl-1-benzofuran-2-yl)-N-({1-[(2-fluorophenyl)methyl]piperidin-4-yl}methyl)-1,2,4-oxadiazole-5-carboxamide
Compound characteristics
| Compound ID: | L288-1127 |
| Compound Name: | 3-(3,5-dimethyl-1-benzofuran-2-yl)-N-({1-[(2-fluorophenyl)methyl]piperidin-4-yl}methyl)-1,2,4-oxadiazole-5-carboxamide |
| Molecular Weight: | 462.52 |
| Molecular Formula: | C26 H27 F N4 O3 |
| Smiles: | Cc1ccc2c(c1)c(C)c(c1nc(C(NCC3CCN(CC3)Cc3ccccc3F)=O)on1)o2 |
| Stereo: | ACHIRAL |
| logP: | 5.3693 |
| logD: | 3.5799 |
| logSw: | -5.555 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.588 |
| InChI Key: | RELGIHHVEWZBDP-UHFFFAOYSA-N |