4-methyl-N-{4-[5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl}benzene-1-sulfonamide
Chemical Structure Depiction of
4-methyl-N-{4-[5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl}benzene-1-sulfonamide
4-methyl-N-{4-[5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | L294-0522 |
| Compound Name: | 4-methyl-N-{4-[5-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl}benzene-1-sulfonamide |
| Molecular Weight: | 481.53 |
| Molecular Formula: | C24 H23 N3 O6 S |
| Smiles: | Cc1ccc(cc1)S(Nc1ccc(cc1)c1nc(c2cc(c(c(c2)OC)OC)OC)on1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9891 |
| logD: | 4.9819 |
| logSw: | -4.6859 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 95.272 |
| InChI Key: | UKUXWNUWYDAMGA-UHFFFAOYSA-N |