1-{4-[4-(1-acetyl-3,3-dimethyl-2,3-dihydro-1H-indole-5-sulfonyl)piperazin-1-yl]phenyl}ethan-1-one
Chemical Structure Depiction of
1-{4-[4-(1-acetyl-3,3-dimethyl-2,3-dihydro-1H-indole-5-sulfonyl)piperazin-1-yl]phenyl}ethan-1-one
1-{4-[4-(1-acetyl-3,3-dimethyl-2,3-dihydro-1H-indole-5-sulfonyl)piperazin-1-yl]phenyl}ethan-1-one
Compound characteristics
| Compound ID: | L302-0118 |
| Compound Name: | 1-{4-[4-(1-acetyl-3,3-dimethyl-2,3-dihydro-1H-indole-5-sulfonyl)piperazin-1-yl]phenyl}ethan-1-one |
| Molecular Weight: | 455.58 |
| Molecular Formula: | C24 H29 N3 O4 S |
| Smiles: | CC(c1ccc(cc1)N1CCN(CC1)S(c1ccc2c(c1)C(C)(C)CN2C(C)=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1105 |
| logD: | 3.1105 |
| logSw: | -3.54 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 65.388 |
| InChI Key: | OKSRQIRVPSEEGY-UHFFFAOYSA-N |