N-tert-butyl-3,3-dimethyl-1-(2-methylpropanoyl)-2,3-dihydro-1H-indole-5-sulfonamide
Chemical Structure Depiction of
N-tert-butyl-3,3-dimethyl-1-(2-methylpropanoyl)-2,3-dihydro-1H-indole-5-sulfonamide
N-tert-butyl-3,3-dimethyl-1-(2-methylpropanoyl)-2,3-dihydro-1H-indole-5-sulfonamide
Compound characteristics
| Compound ID: | L302-0815 |
| Compound Name: | N-tert-butyl-3,3-dimethyl-1-(2-methylpropanoyl)-2,3-dihydro-1H-indole-5-sulfonamide |
| Molecular Weight: | 352.49 |
| Molecular Formula: | C18 H28 N2 O3 S |
| Smiles: | CC(C)C(N1CC(C)(C)c2cc(ccc12)S(NC(C)(C)C)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.543 |
| logD: | 3.5429 |
| logSw: | -3.8765 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.189 |
| InChI Key: | UGMPNPHEYRARID-UHFFFAOYSA-N |