N-(3-chlorophenyl)-N'-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea
Chemical Structure Depiction of
N-(3-chlorophenyl)-N'-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea
N-(3-chlorophenyl)-N'-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea
Compound characteristics
| Compound ID: | L317-0200 |
| Compound Name: | N-(3-chlorophenyl)-N'-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea |
| Molecular Weight: | 379.82 |
| Molecular Formula: | C21 H15 Cl F N3 O |
| Smiles: | c1cc(cc(c1)[Cl])NC(Nc1ccc(cc1)c1cc2cc(ccc2[nH]1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 6.6113 |
| logD: | 6.6113 |
| logSw: | -6.6473 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 41.619 |
| InChI Key: | IVFXNKFOXKZHAI-UHFFFAOYSA-N |