N-[4-(5-fluoro-1H-indol-2-yl)phenyl]-N'-(2-methylphenyl)urea
Chemical Structure Depiction of
N-[4-(5-fluoro-1H-indol-2-yl)phenyl]-N'-(2-methylphenyl)urea
N-[4-(5-fluoro-1H-indol-2-yl)phenyl]-N'-(2-methylphenyl)urea
Compound characteristics
| Compound ID: | L317-0217 |
| Compound Name: | N-[4-(5-fluoro-1H-indol-2-yl)phenyl]-N'-(2-methylphenyl)urea |
| Molecular Weight: | 359.4 |
| Molecular Formula: | C22 H18 F N3 O |
| Smiles: | Cc1ccccc1NC(Nc1ccc(cc1)c1cc2cc(ccc2[nH]1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6535 |
| logD: | 5.6535 |
| logSw: | -5.7872 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 40.921 |
| InChI Key: | FCILDUKUTMAWMW-UHFFFAOYSA-N |