N-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-N'-cyclopentylurea
Chemical Structure Depiction of
N-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-N'-cyclopentylurea
N-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-N'-cyclopentylurea
Compound characteristics
| Compound ID: | L320-0341 |
| Compound Name: | N-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-N'-cyclopentylurea |
| Molecular Weight: | 371.89 |
| Molecular Formula: | C19 H18 Cl N3 O S |
| Smiles: | C1CCC(C1)NC(Nc1ccc(c(c1)[Cl])c1nc2ccccc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5978 |
| logD: | 5.5978 |
| logSw: | -6.0639 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 43.404 |
| InChI Key: | UICQECVTMNRIMZ-UHFFFAOYSA-N |