N-[1,3-diethyl-6-(4-methoxybenzene-1-sulfonyl)-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-[1,3-diethyl-6-(4-methoxybenzene-1-sulfonyl)-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl]thiophene-2-carboxamide
N-[1,3-diethyl-6-(4-methoxybenzene-1-sulfonyl)-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | L322-0307 |
| Compound Name: | N-[1,3-diethyl-6-(4-methoxybenzene-1-sulfonyl)-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl]thiophene-2-carboxamide |
| Molecular Weight: | 485.58 |
| Molecular Formula: | C23 H23 N3 O5 S2 |
| Smiles: | CCN1C(N(CC)c2cc(c(cc12)NC(c1cccs1)=O)S(c1ccc(cc1)OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5786 |
| logD: | 4.5771 |
| logSw: | -4.305 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.298 |
| InChI Key: | PPPVGPUSNYNJBZ-UHFFFAOYSA-N |