N-[6-(cyclohexanesulfonyl)-1,3-diethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl]-2-(2-methylphenyl)acetamide
Chemical Structure Depiction of
N-[6-(cyclohexanesulfonyl)-1,3-diethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl]-2-(2-methylphenyl)acetamide
N-[6-(cyclohexanesulfonyl)-1,3-diethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl]-2-(2-methylphenyl)acetamide
Compound characteristics
| Compound ID: | L322-0673 |
| Compound Name: | N-[6-(cyclohexanesulfonyl)-1,3-diethyl-2-oxo-2,3-dihydro-1H-benzimidazol-5-yl]-2-(2-methylphenyl)acetamide |
| Molecular Weight: | 483.63 |
| Molecular Formula: | C26 H33 N3 O4 S |
| Smiles: | CCN1C(N(CC)c2cc(c(cc12)NC(Cc1ccccc1C)=O)S(C1CCCCC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5741 |
| logD: | 5.57 |
| logSw: | -5.2284 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.714 |
| InChI Key: | PKVATDFRNOIAOJ-UHFFFAOYSA-N |