N-cyclohexyl-2-(4-cyclohexylpiperazin-1-yl)-6-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine
Chemical Structure Depiction of
N-cyclohexyl-2-(4-cyclohexylpiperazin-1-yl)-6-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine
N-cyclohexyl-2-(4-cyclohexylpiperazin-1-yl)-6-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine
Compound characteristics
| Compound ID: | L327-1843 |
| Compound Name: | N-cyclohexyl-2-(4-cyclohexylpiperazin-1-yl)-6-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine |
| Molecular Weight: | 482.67 |
| Molecular Formula: | C26 H35 F N6 S |
| Smiles: | C1CCC(CC1)Nc1c(c2cccc(c2)F)nc2n1nc(N1CCN(CC1)C1CCCCC1)s2 |
| Stereo: | ACHIRAL |
| logP: | 6.3536 |
| logD: | 5.536 |
| logSw: | -6.2735 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.503 |
| InChI Key: | LUFRZLNCNJEYKZ-UHFFFAOYSA-N |