4-[5-(tert-butylamino)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N-(propan-2-yl)piperazine-1-carboxamide
Chemical Structure Depiction of
4-[5-(tert-butylamino)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N-(propan-2-yl)piperazine-1-carboxamide
4-[5-(tert-butylamino)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N-(propan-2-yl)piperazine-1-carboxamide
Compound characteristics
| Compound ID: | L327-9460 |
| Compound Name: | 4-[5-(tert-butylamino)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N-(propan-2-yl)piperazine-1-carboxamide |
| Molecular Weight: | 441.6 |
| Molecular Formula: | C22 H31 N7 O S |
| Smiles: | CC(C)NC(N1CCN(CC1)c1nn2c(c(c3ccccc3)nc2s1)NC(C)(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2189 |
| logD: | 4.2187 |
| logSw: | -4.0547 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.625 |
| InChI Key: | AOZZLDJPKSDKKJ-UHFFFAOYSA-N |