N-(4-fluorophenyl)-4-{2-[2-(3-fluorophenyl)acetamido]ethyl}piperidine-1-carboxamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-4-{2-[2-(3-fluorophenyl)acetamido]ethyl}piperidine-1-carboxamide
N-(4-fluorophenyl)-4-{2-[2-(3-fluorophenyl)acetamido]ethyl}piperidine-1-carboxamide
Compound characteristics
| Compound ID: | L333-0568 |
| Compound Name: | N-(4-fluorophenyl)-4-{2-[2-(3-fluorophenyl)acetamido]ethyl}piperidine-1-carboxamide |
| Molecular Weight: | 401.46 |
| Molecular Formula: | C22 H25 F2 N3 O2 |
| Smiles: | [H]N(C(N1CCC(CCNC(Cc2cccc(c2)F)=O)CC1)=O)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 3.2392 |
| logD: | 3.2392 |
| logSw: | -3.4572 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.749 |
| InChI Key: | CNTFNHCONQNYPQ-UHFFFAOYSA-N |