N-(2-fluorophenyl)-4-[2-(2-phenylacetamido)ethyl]piperidine-1-carboxamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-4-[2-(2-phenylacetamido)ethyl]piperidine-1-carboxamide
N-(2-fluorophenyl)-4-[2-(2-phenylacetamido)ethyl]piperidine-1-carboxamide
Compound characteristics
| Compound ID: | L334-1552 |
| Compound Name: | N-(2-fluorophenyl)-4-[2-(2-phenylacetamido)ethyl]piperidine-1-carboxamide |
| Molecular Weight: | 383.46 |
| Molecular Formula: | C22 H26 F N3 O2 |
| Smiles: | C(CNC(Cc1ccccc1)=O)C1CCN(CC1)C(Nc1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2186 |
| logD: | 3.2186 |
| logSw: | -3.3061 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.051 |
| InChI Key: | JLAZITIJZOWZMC-UHFFFAOYSA-N |