2-[4-(dimethylamino)phenyl]-7-ethoxy-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-3-amine
Chemical Structure Depiction of
2-[4-(dimethylamino)phenyl]-7-ethoxy-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-3-amine
2-[4-(dimethylamino)phenyl]-7-ethoxy-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-3-amine
Compound characteristics
| Compound ID: | L350-2021 |
| Compound Name: | 2-[4-(dimethylamino)phenyl]-7-ethoxy-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-3-amine |
| Molecular Weight: | 410.54 |
| Molecular Formula: | C22 H26 N4 O2 S |
| Smiles: | CCOc1ccc2c(c1)sc1nc(c3ccc(cc3)N(C)C)c(NCCOC)n12 |
| Stereo: | ACHIRAL |
| logP: | 4.9354 |
| logD: | 4.9277 |
| logSw: | -4.5684 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.533 |
| InChI Key: | QFPHBVSIRUKODW-UHFFFAOYSA-N |