7-ethoxy-N-(2-methoxyethyl)-2-(3,4,5-trimethoxyphenyl)imidazo[2,1-b][1,3]benzothiazol-3-amine
Chemical Structure Depiction of
7-ethoxy-N-(2-methoxyethyl)-2-(3,4,5-trimethoxyphenyl)imidazo[2,1-b][1,3]benzothiazol-3-amine
7-ethoxy-N-(2-methoxyethyl)-2-(3,4,5-trimethoxyphenyl)imidazo[2,1-b][1,3]benzothiazol-3-amine
Compound characteristics
| Compound ID: | L350-2515 |
| Compound Name: | 7-ethoxy-N-(2-methoxyethyl)-2-(3,4,5-trimethoxyphenyl)imidazo[2,1-b][1,3]benzothiazol-3-amine |
| Molecular Weight: | 457.55 |
| Molecular Formula: | C23 H27 N3 O5 S |
| Smiles: | CCOc1ccc2c(c1)sc1nc(c3cc(c(c(c3)OC)OC)OC)c(NCCOC)n12 |
| Stereo: | ACHIRAL |
| logP: | 4.5897 |
| logD: | 3.2695 |
| logSw: | -4.3797 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.706 |
| InChI Key: | XSXKLWHDPCXHEP-UHFFFAOYSA-N |