7-chloro-2-[4-(dimethylamino)phenyl]-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-3-amine
Chemical Structure Depiction of
7-chloro-2-[4-(dimethylamino)phenyl]-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-3-amine
7-chloro-2-[4-(dimethylamino)phenyl]-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-3-amine
Compound characteristics
| Compound ID: | L350-2689 |
| Compound Name: | 7-chloro-2-[4-(dimethylamino)phenyl]-N-(2-methoxyethyl)imidazo[2,1-b][1,3]benzothiazol-3-amine |
| Molecular Weight: | 400.93 |
| Molecular Formula: | C20 H21 Cl N4 O S |
| Smiles: | CN(C)c1ccc(cc1)c1c(NCCOC)n2c3ccc(cc3sc2n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.1128 |
| logD: | 5.1062 |
| logSw: | -5.6164 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.409 |
| InChI Key: | BDZYUDCQYGBEHS-UHFFFAOYSA-N |