4-{5-[(4-chlorobenzene-1-sulfonyl)amino]-1-methyl-1H-benzimidazol-2-yl}-N-methylbenzamide
Chemical Structure Depiction of
4-{5-[(4-chlorobenzene-1-sulfonyl)amino]-1-methyl-1H-benzimidazol-2-yl}-N-methylbenzamide
4-{5-[(4-chlorobenzene-1-sulfonyl)amino]-1-methyl-1H-benzimidazol-2-yl}-N-methylbenzamide
Compound characteristics
| Compound ID: | L364-0077 |
| Compound Name: | 4-{5-[(4-chlorobenzene-1-sulfonyl)amino]-1-methyl-1H-benzimidazol-2-yl}-N-methylbenzamide |
| Molecular Weight: | 454.93 |
| Molecular Formula: | C22 H19 Cl N4 O3 S |
| Smiles: | CNC(c1ccc(cc1)c1nc2cc(ccc2n1C)NS(c1ccc(cc1)[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1191 |
| logD: | 4.033 |
| logSw: | -4.5197 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 76.462 |
| InChI Key: | CTPXDDHBTCNWOL-UHFFFAOYSA-N |