N-cyclopentyl-1,3-dimethyl-4-(4-methylanilino)-1H-pyrazolo[3,4-b]pyridine-5-carboxamide
Chemical Structure Depiction of
N-cyclopentyl-1,3-dimethyl-4-(4-methylanilino)-1H-pyrazolo[3,4-b]pyridine-5-carboxamide
N-cyclopentyl-1,3-dimethyl-4-(4-methylanilino)-1H-pyrazolo[3,4-b]pyridine-5-carboxamide
Compound characteristics
| Compound ID: | L371-2465 |
| Compound Name: | N-cyclopentyl-1,3-dimethyl-4-(4-methylanilino)-1H-pyrazolo[3,4-b]pyridine-5-carboxamide |
| Molecular Weight: | 363.46 |
| Molecular Formula: | C21 H25 N5 O |
| Smiles: | Cc1ccc(cc1)Nc1c(cnc2c1c(C)nn2C)C(NC1CCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2248 |
| logD: | 3.2231 |
| logSw: | -3.7887 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.599 |
| InChI Key: | IDVLTDDYZZRFPB-UHFFFAOYSA-N |