N-[(3-fluorophenyl)methyl]-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-[(3-fluorophenyl)methyl]-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
N-[(3-fluorophenyl)methyl]-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | L372-0955 |
| Compound Name: | N-[(3-fluorophenyl)methyl]-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide |
| Molecular Weight: | 458.41 |
| Molecular Formula: | C24 H18 F4 N2 O3 |
| Smiles: | C1CC2=C(C=C(C(NCc3cccc(c3)F)=O)C(N2c2ccc(cc2)C(F)(F)F)=O)C(C1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4947 |
| logD: | 3.4928 |
| logSw: | -3.9486 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.993 |
| InChI Key: | DANHNWPDGRWSIF-UHFFFAOYSA-N |