N-(2-ethylphenyl)-2-({6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-2-({6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl}sulfanyl)acetamide
N-(2-ethylphenyl)-2-({6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | L383-1070 |
| Compound Name: | N-(2-ethylphenyl)-2-({6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazin-3-yl}sulfanyl)acetamide |
| Molecular Weight: | 463.6 |
| Molecular Formula: | C25 H29 N5 O2 S |
| Smiles: | CCc1ccccc1NC(CSc1ccc(nn1)N1CCN(CC1)c1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5062 |
| logD: | 4.506 |
| logSw: | -4.1625 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.028 |
| InChI Key: | CYBGDVLRSVYCCA-UHFFFAOYSA-N |