2-({6-[4-(2-chlorophenyl)piperazin-1-yl]pyridazin-3-yl}sulfanyl)-N-(3-ethylphenyl)acetamide
Chemical Structure Depiction of
2-({6-[4-(2-chlorophenyl)piperazin-1-yl]pyridazin-3-yl}sulfanyl)-N-(3-ethylphenyl)acetamide
2-({6-[4-(2-chlorophenyl)piperazin-1-yl]pyridazin-3-yl}sulfanyl)-N-(3-ethylphenyl)acetamide
Compound characteristics
| Compound ID: | L383-1228 |
| Compound Name: | 2-({6-[4-(2-chlorophenyl)piperazin-1-yl]pyridazin-3-yl}sulfanyl)-N-(3-ethylphenyl)acetamide |
| Molecular Weight: | 468.02 |
| Molecular Formula: | C24 H26 Cl N5 O S |
| Smiles: | CCc1cccc(c1)NC(CSc1ccc(nn1)N1CCN(CC1)c1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.471 |
| logD: | 5.471 |
| logSw: | -5.9001 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.096 |
| InChI Key: | IDOZQKZBEFJRSN-UHFFFAOYSA-N |