3-{[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}[1]benzofuro[3,2-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
3-{[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}[1]benzofuro[3,2-d]pyrimidin-4(3H)-one
3-{[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}[1]benzofuro[3,2-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | L388-0142 |
| Compound Name: | 3-{[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}[1]benzofuro[3,2-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 378.77 |
| Molecular Formula: | C19 H11 Cl N4 O3 |
| Smiles: | C(c1nc(c2cccc(c2)[Cl])no1)N1C=Nc2c3ccccc3oc2C1=O |
| Stereo: | ACHIRAL |
| logP: | 4.3654 |
| logD: | 4.3654 |
| logSw: | -4.6494 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 63.577 |
| InChI Key: | ZOPKKUXLJJRLTB-UHFFFAOYSA-N |