N-[2-(2,3-dihydro-1H-indol-1-yl)-2-oxoethyl]-N'-[(4-fluorophenyl)methyl]urea
Chemical Structure Depiction of
N-[2-(2,3-dihydro-1H-indol-1-yl)-2-oxoethyl]-N'-[(4-fluorophenyl)methyl]urea
N-[2-(2,3-dihydro-1H-indol-1-yl)-2-oxoethyl]-N'-[(4-fluorophenyl)methyl]urea
Compound characteristics
| Compound ID: | L409-0266 |
| Compound Name: | N-[2-(2,3-dihydro-1H-indol-1-yl)-2-oxoethyl]-N'-[(4-fluorophenyl)methyl]urea |
| Molecular Weight: | 327.36 |
| Molecular Formula: | C18 H18 F N3 O2 |
| Smiles: | [H]C(C(N1CCc2ccccc12)=O)NC(NCc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8669 |
| logD: | 1.8669 |
| logSw: | -2.1474 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.609 |
| InChI Key: | NSDOFORJBPSEKY-UHFFFAOYSA-N |