2-{[1-(3-chloro-4-methylphenyl)-6-oxo-1,6-dihydropyridazin-3-yl]sulfanyl}-N-(3-ethylphenyl)propanamide
Chemical Structure Depiction of
2-{[1-(3-chloro-4-methylphenyl)-6-oxo-1,6-dihydropyridazin-3-yl]sulfanyl}-N-(3-ethylphenyl)propanamide
2-{[1-(3-chloro-4-methylphenyl)-6-oxo-1,6-dihydropyridazin-3-yl]sulfanyl}-N-(3-ethylphenyl)propanamide
Compound characteristics
| Compound ID: | L414-1414 |
| Compound Name: | 2-{[1-(3-chloro-4-methylphenyl)-6-oxo-1,6-dihydropyridazin-3-yl]sulfanyl}-N-(3-ethylphenyl)propanamide |
| Molecular Weight: | 427.95 |
| Molecular Formula: | C22 H22 Cl N3 O2 S |
| Smiles: | CCc1cccc(c1)NC(C(C)SC1C=CC(N(c2ccc(C)c(c2)[Cl])N=1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5567 |
| logD: | 5.5567 |
| logSw: | -5.9627 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.911 |
| InChI Key: | AQOHPJFNAYIQSO-HNNXBMFYSA-N |