2-{[1-(4-methylphenyl)-6-oxo-1,6-dihydropyridazin-3-yl]sulfanyl}-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide
Chemical Structure Depiction of
2-{[1-(4-methylphenyl)-6-oxo-1,6-dihydropyridazin-3-yl]sulfanyl}-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide
2-{[1-(4-methylphenyl)-6-oxo-1,6-dihydropyridazin-3-yl]sulfanyl}-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide
Compound characteristics
| Compound ID: | L414-1762 |
| Compound Name: | 2-{[1-(4-methylphenyl)-6-oxo-1,6-dihydropyridazin-3-yl]sulfanyl}-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide |
| Molecular Weight: | 469.56 |
| Molecular Formula: | C24 H27 N3 O5 S |
| Smiles: | CC(C(NCc1cc(c(c(c1)OC)OC)OC)=O)SC1C=CC(N(c2ccc(C)cc2)N=1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2288 |
| logD: | 3.2288 |
| logSw: | -3.4691 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.211 |
| InChI Key: | RAWKYNVSNRXVAS-INIZCTEOSA-N |