1-[(4-methoxyphenyl)methyl]-N-[(pyridin-3-yl)methyl]-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
1-[(4-methoxyphenyl)methyl]-N-[(pyridin-3-yl)methyl]-1H-benzotriazole-5-carboxamide
1-[(4-methoxyphenyl)methyl]-N-[(pyridin-3-yl)methyl]-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | L455-0009 |
| Compound Name: | 1-[(4-methoxyphenyl)methyl]-N-[(pyridin-3-yl)methyl]-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 373.41 |
| Molecular Formula: | C21 H19 N5 O2 |
| Smiles: | COc1ccc(Cn2c3ccc(cc3nn2)C(NCc2cccnc2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 1.8175 |
| logD: | 1.8174 |
| logSw: | -1.7016 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.139 |
| InChI Key: | MDYHOUNOPKAISP-UHFFFAOYSA-N |