N-cycloheptyl-1-[(4-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
N-cycloheptyl-1-[(4-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide
N-cycloheptyl-1-[(4-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | L455-0027 |
| Compound Name: | N-cycloheptyl-1-[(4-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 378.47 |
| Molecular Formula: | C22 H26 N4 O2 |
| Smiles: | COc1ccc(Cn2c3ccc(cc3nn2)C(NC2CCCCCC2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.8738 |
| logD: | 3.8738 |
| logSw: | -4.0714 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.678 |
| InChI Key: | SQOWJJIVIDXFFF-UHFFFAOYSA-N |