N-(3-acetylphenyl)-1-[(3-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
N-(3-acetylphenyl)-1-[(3-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide
N-(3-acetylphenyl)-1-[(3-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | L455-0361 |
| Compound Name: | N-(3-acetylphenyl)-1-[(3-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 400.44 |
| Molecular Formula: | C23 H20 N4 O3 |
| Smiles: | CC(c1cccc(c1)NC(c1ccc2c(c1)nnn2Cc1cccc(c1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1932 |
| logD: | 3.189 |
| logSw: | -3.3984 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.126 |
| InChI Key: | XRFBUCPUTJIRBO-UHFFFAOYSA-N |