N-(2-methoxyethyl)-1-[(3-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
N-(2-methoxyethyl)-1-[(3-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide
N-(2-methoxyethyl)-1-[(3-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | L455-0364 |
| Compound Name: | N-(2-methoxyethyl)-1-[(3-methoxyphenyl)methyl]-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 340.38 |
| Molecular Formula: | C18 H20 N4 O3 |
| Smiles: | COCCNC(c1ccc2c(c1)nnn2Cc1cccc(c1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6111 |
| logD: | 1.6111 |
| logSw: | -2.1529 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.077 |
| InChI Key: | YCMYECSUZGIEBO-UHFFFAOYSA-N |