N-(4-chlorophenyl)-2-[(3-methyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-2-[(3-methyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetamide
N-(4-chlorophenyl)-2-[(3-methyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | L459-0163 |
| Compound Name: | N-(4-chlorophenyl)-2-[(3-methyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetamide |
| Molecular Weight: | 441.96 |
| Molecular Formula: | C21 H16 Cl N3 O2 S2 |
| Smiles: | CN1C(=Nc2cc(c3ccccc3)sc2C1=O)SCC(Nc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.9193 |
| logD: | 4.9193 |
| logSw: | -5.0344 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.704 |
| InChI Key: | JFTVYABCNPZPFE-UHFFFAOYSA-N |