2-[(3-ethyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]-N-(3-methylphenyl)acetamide
Chemical Structure Depiction of
2-[(3-ethyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]-N-(3-methylphenyl)acetamide
2-[(3-ethyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]-N-(3-methylphenyl)acetamide
Compound characteristics
| Compound ID: | L459-0207 |
| Compound Name: | 2-[(3-ethyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]-N-(3-methylphenyl)acetamide |
| Molecular Weight: | 435.57 |
| Molecular Formula: | C23 H21 N3 O2 S2 |
| Smiles: | CCN1C(=Nc2cc(c3ccccc3)sc2C1=O)SCC(Nc1cccc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2353 |
| logD: | 5.2353 |
| logSw: | -4.9935 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.664 |
| InChI Key: | RZVINCTXQZRNFP-UHFFFAOYSA-N |