methyl [(3-methyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetate
Chemical Structure Depiction of
methyl [(3-methyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetate
methyl [(3-methyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetate
Compound characteristics
| Compound ID: | L460-0005 |
| Compound Name: | methyl [(3-methyl-4-oxo-6-phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetate |
| Molecular Weight: | 346.42 |
| Molecular Formula: | C16 H14 N2 O3 S2 |
| Smiles: | CN1C(=Nc2cc(c3ccccc3)sc2C1=O)SCC(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.9446 |
| logD: | 2.9446 |
| logSw: | -3.4495 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 47.405 |
| InChI Key: | GSBMUDQQDNZNEI-UHFFFAOYSA-N |