3-ethyl-6-phenyl-2-{[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
3-ethyl-6-phenyl-2-{[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one
3-ethyl-6-phenyl-2-{[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | L460-0086 |
| Compound Name: | 3-ethyl-6-phenyl-2-{[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]sulfanyl}thieno[3,2-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 446.55 |
| Molecular Formula: | C23 H18 N4 O2 S2 |
| Smiles: | CCN1C(=Nc2cc(c3ccccc3)sc2C1=O)SCc1nc(c2ccccc2)no1 |
| Stereo: | ACHIRAL |
| logP: | 5.9191 |
| logD: | 5.9191 |
| logSw: | -5.4526 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 57.857 |
| InChI Key: | UVFWPTLFFNPBKX-UHFFFAOYSA-N |