2-(2-bromophenyl)-N-{[5-(piperidine-1-sulfonyl)thiophen-2-yl]methyl}acetamide
Chemical Structure Depiction of
2-(2-bromophenyl)-N-{[5-(piperidine-1-sulfonyl)thiophen-2-yl]methyl}acetamide
2-(2-bromophenyl)-N-{[5-(piperidine-1-sulfonyl)thiophen-2-yl]methyl}acetamide
Compound characteristics
| Compound ID: | L470-0155 |
| Compound Name: | 2-(2-bromophenyl)-N-{[5-(piperidine-1-sulfonyl)thiophen-2-yl]methyl}acetamide |
| Molecular Weight: | 457.41 |
| Molecular Formula: | C18 H21 Br N2 O3 S2 |
| Smiles: | C1CCN(CC1)S(c1ccc(CNC(Cc2ccccc2[Br])=O)s1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8253 |
| logD: | 3.8253 |
| logSw: | -3.9639 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.168 |
| InChI Key: | YFMCVPRNRGDRBL-UHFFFAOYSA-N |