N-{[5-(azepane-1-sulfonyl)thiophen-2-yl]methyl}-3-methylbenzamide
Chemical Structure Depiction of
N-{[5-(azepane-1-sulfonyl)thiophen-2-yl]methyl}-3-methylbenzamide
N-{[5-(azepane-1-sulfonyl)thiophen-2-yl]methyl}-3-methylbenzamide
Compound characteristics
| Compound ID: | L470-0669 |
| Compound Name: | N-{[5-(azepane-1-sulfonyl)thiophen-2-yl]methyl}-3-methylbenzamide |
| Molecular Weight: | 392.54 |
| Molecular Formula: | C19 H24 N2 O3 S2 |
| Smiles: | Cc1cccc(c1)C(NCc1ccc(s1)S(N1CCCCCC1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9201 |
| logD: | 3.9201 |
| logSw: | -3.8462 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.712 |
| InChI Key: | XIDKBIOSFUCHJO-UHFFFAOYSA-N |