N-[(4-chlorophenyl)methyl]-3-[4-(pyrrolidin-1-yl)phenyl]-1,2,4-oxadiazole-5-carboxamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-3-[4-(pyrrolidin-1-yl)phenyl]-1,2,4-oxadiazole-5-carboxamide
N-[(4-chlorophenyl)methyl]-3-[4-(pyrrolidin-1-yl)phenyl]-1,2,4-oxadiazole-5-carboxamide
Compound characteristics
| Compound ID: | L471-0033 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-3-[4-(pyrrolidin-1-yl)phenyl]-1,2,4-oxadiazole-5-carboxamide |
| Molecular Weight: | 382.85 |
| Molecular Formula: | C20 H19 Cl N4 O2 |
| Smiles: | C1CCN(C1)c1ccc(cc1)c1nc(C(NCc2ccc(cc2)[Cl])=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.6098 |
| logD: | 4.6097 |
| logSw: | -4.9045 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.147 |
| InChI Key: | LANIGPCUZSFRLN-UHFFFAOYSA-N |