N-[3-(3,4-dihydroquinolin-1(2H)-yl)propyl]-3-[4-(morpholin-4-yl)phenyl]-1,2,4-oxadiazole-5-carboxamide
					Chemical Structure Depiction of
N-[3-(3,4-dihydroquinolin-1(2H)-yl)propyl]-3-[4-(morpholin-4-yl)phenyl]-1,2,4-oxadiazole-5-carboxamide
			N-[3-(3,4-dihydroquinolin-1(2H)-yl)propyl]-3-[4-(morpholin-4-yl)phenyl]-1,2,4-oxadiazole-5-carboxamide
Compound characteristics
| Compound ID: | L471-1458 | 
| Compound Name: | N-[3-(3,4-dihydroquinolin-1(2H)-yl)propyl]-3-[4-(morpholin-4-yl)phenyl]-1,2,4-oxadiazole-5-carboxamide | 
| Molecular Weight: | 447.54 | 
| Molecular Formula: | C25 H29 N5 O3 | 
| Smiles: | C1Cc2ccccc2N(C1)CCCNC(c1nc(c2ccc(cc2)N2CCOCC2)no1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.7528 | 
| logD: | 3.7034 | 
| logSw: | -4.1044 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 70.344 | 
| InChI Key: | ICDBECNJSFGLAZ-UHFFFAOYSA-N | 
 
				 
				