methyl 4-[2-(benzylamino)-2-oxoethoxy]-6-methoxyquinoline-2-carboxylate
Chemical Structure Depiction of
methyl 4-[2-(benzylamino)-2-oxoethoxy]-6-methoxyquinoline-2-carboxylate
methyl 4-[2-(benzylamino)-2-oxoethoxy]-6-methoxyquinoline-2-carboxylate
Compound characteristics
| Compound ID: | L479-0177 |
| Compound Name: | methyl 4-[2-(benzylamino)-2-oxoethoxy]-6-methoxyquinoline-2-carboxylate |
| Molecular Weight: | 380.4 |
| Molecular Formula: | C21 H20 N2 O5 |
| Smiles: | COC(c1cc(c2cc(ccc2n1)OC)OCC(NCc1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9792 |
| logD: | 2.9792 |
| logSw: | -3.2878 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.073 |
| InChI Key: | ABGXMBQTCQJGBR-UHFFFAOYSA-N |