methyl 6-methoxy-4-[(2-methylphenyl)methoxy]quinoline-2-carboxylate
Chemical Structure Depiction of
methyl 6-methoxy-4-[(2-methylphenyl)methoxy]quinoline-2-carboxylate
methyl 6-methoxy-4-[(2-methylphenyl)methoxy]quinoline-2-carboxylate
Compound characteristics
| Compound ID: | L479-0246 |
| Compound Name: | methyl 6-methoxy-4-[(2-methylphenyl)methoxy]quinoline-2-carboxylate |
| Molecular Weight: | 337.37 |
| Molecular Formula: | C20 H19 N O4 |
| Smiles: | Cc1ccccc1COc1cc(C(=O)OC)nc2ccc(cc12)OC |
| Stereo: | ACHIRAL |
| logP: | 4.5852 |
| logD: | 4.5852 |
| logSw: | -4.5596 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.601 |
| InChI Key: | XGXMRIOHOOEUIB-UHFFFAOYSA-N |