methyl 6-chloro-4-[2-(2,5-difluoroanilino)-2-oxoethoxy]quinoline-2-carboxylate
Chemical Structure Depiction of
methyl 6-chloro-4-[2-(2,5-difluoroanilino)-2-oxoethoxy]quinoline-2-carboxylate
methyl 6-chloro-4-[2-(2,5-difluoroanilino)-2-oxoethoxy]quinoline-2-carboxylate
Compound characteristics
| Compound ID: | L479-0403 |
| Compound Name: | methyl 6-chloro-4-[2-(2,5-difluoroanilino)-2-oxoethoxy]quinoline-2-carboxylate |
| Molecular Weight: | 406.77 |
| Molecular Formula: | C19 H13 Cl F2 N2 O4 |
| Smiles: | COC(c1cc(c2cc(ccc2n1)[Cl])OCC(Nc1cc(ccc1F)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2751 |
| logD: | 4.2624 |
| logSw: | -4.4931 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.509 |
| InChI Key: | HRJWBOKSQNYSSC-UHFFFAOYSA-N |