methyl 6-ethoxy-4-(2-methoxyanilino)quinoline-2-carboxylate
Chemical Structure Depiction of
methyl 6-ethoxy-4-(2-methoxyanilino)quinoline-2-carboxylate
methyl 6-ethoxy-4-(2-methoxyanilino)quinoline-2-carboxylate
Compound characteristics
| Compound ID: | L480-0815 |
| Compound Name: | methyl 6-ethoxy-4-(2-methoxyanilino)quinoline-2-carboxylate |
| Molecular Weight: | 352.39 |
| Molecular Formula: | C20 H20 N2 O4 |
| Smiles: | CCOc1ccc2c(c1)c(cc(C(=O)OC)n2)Nc1ccccc1OC |
| Stereo: | ACHIRAL |
| logP: | 4.7181 |
| logD: | 4.7168 |
| logSw: | -4.5582 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.014 |
| InChI Key: | DWIHTUISDYCXOK-UHFFFAOYSA-N |